Post by Anders Hoveland on Feb 3, 2011 16:57:13 GMT -8
Sodium iodide can react with methyl bromide.
This is known as the Finkelstein reaction. The NaBr only solidifies out because it is less soluble in the (typically acetone) solvent. The reaction tends to be very slow, taking days or months without an appropriate catalyst.
Otherwise, formation of the iodide ion is somewhat more favorable than that of the bromine ion.
One catalyst idea is a beta-diketiminate complex.
condense acetylacetone with methylamine, using a strong base, to form a double imine.
This has a structure of CH3C(=NCH3)CH2C(=NCH3)CH3
Now add Cu+2 ions. This could potentially form an unusual aromatic complex.
...........(+)
CH3--N--Cu--N--CH3
.........ll.........l
CH3--C--CH=C--CH3 H(+)
As you can hopefully see, the acetylacetone imine becomes deprotonated (acetylacetone is known to sometimes behave as an acid)
The aromatic copper complex would have a net charge of +1
The ring has several resonance states.
Copper acetylacetonate, for example, is an interesting complex with a surprisingly high vapor pressure. However, the two methyl groups from the CH3NH2 would be expected to sterically hinder a second ring from forming, which is the case with the plain copper acetylacetonate complex salt.
quick thought: there exists an alloy of potassium and sodium metal which is liquid at room temperature. A thought would be to blast this into a spray that would immediately ignite in air to form a caustic fireball. Extreme hazard of chemical burns.
This is known as the Finkelstein reaction. The NaBr only solidifies out because it is less soluble in the (typically acetone) solvent. The reaction tends to be very slow, taking days or months without an appropriate catalyst.
Otherwise, formation of the iodide ion is somewhat more favorable than that of the bromine ion.
One catalyst idea is a beta-diketiminate complex.
condense acetylacetone with methylamine, using a strong base, to form a double imine.
This has a structure of CH3C(=NCH3)CH2C(=NCH3)CH3
Now add Cu+2 ions. This could potentially form an unusual aromatic complex.
...........(+)
CH3--N--Cu--N--CH3
.........ll.........l
CH3--C--CH=C--CH3 H(+)
As you can hopefully see, the acetylacetone imine becomes deprotonated (acetylacetone is known to sometimes behave as an acid)
The aromatic copper complex would have a net charge of +1
The ring has several resonance states.
Copper acetylacetonate, for example, is an interesting complex with a surprisingly high vapor pressure. However, the two methyl groups from the CH3NH2 would be expected to sterically hinder a second ring from forming, which is the case with the plain copper acetylacetonate complex salt.
quick thought: there exists an alloy of potassium and sodium metal which is liquid at room temperature. A thought would be to blast this into a spray that would immediately ignite in air to form a caustic fireball. Extreme hazard of chemical burns.
